ChemNet > CAS > 78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
| उत्पाद का नाम |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile |
| अंग्रेजी नाम |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile;2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzonitrile |
| आणविक फार्मूला |
C13H7ClN2O2S |
| आण्विक वजन |
290.7249 |
| InChI |
InChI=1/C13H7ClN2O2S/c14-10-1-4-12(5-2-10)19-13-6-3-11(16(17)18)7-9(13)8-15/h1-7H |
| कैस रजिस्टी संख्या |
78940-73-5 |
| आणविक संरचना |
![78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile](https://images-a.chemnet.com/suppliers/chembase/116/11671.gif)
|
| घनत्व |
1.47g/cm3 |
| गलनांक |
167℃ |
| उबलने का समय |
452.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.685 |
| फ्लैश प्वाइंट |
227.6°C |
| वाष्प का दबाव |
2.18E-08mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
